C21H16NO6S- — CID 57205188
2-[[carboxy-(4-methoxyphenyl)methyl]-sulfinatoamino]dibenzofuran (PubChem CID 57205188) has the molecular formula C21H16NO6S- and a molecular weight of 410.43 g/mol. Its IUPAC name is 2-[[carboxy-(4-methoxyphenyl)methyl]-sulfinatoamino]dibenzofuran.
| Compound Name | 2-[[carboxy-(4-methoxyphenyl)methyl]-sulfinatoamino]dibenzofuran |
|---|---|
| PubChem CID | 57205188 |
| Molecular Formula | C21H16NO6S- |
| Molecular Weight | 410.43 g/mol |
| Exact Mass | 410.07 |
| IUPAC Name | 2-[[carboxy-(4-methoxyphenyl)methyl]-sulfinatoamino]dibenzofuran |
| SMILES | COc1ccc(C(C(=O)O)N(c2ccc3oc4ccccc4c3c2)S(=O)[O-])cc1 |
| InChI | InChI=1S/C21H17NO6S/c1-27-15-9-6-13(7-10-15)20(21(23)24)22(29(25)26)14-8-11-19-17(12-14)16-4-2-3-5-18(16)28-19/h2-12,20H,1H3,(H,23,24)(H,25,26)/p-1 |
| InChIKey | AKDIYXDGVRSLNC-UHFFFAOYSA-M |
| XLogP | 4.02 |
| TPSA | 103.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.43 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|