dibenzofuran-2-yl hydrogen sulfite

C12H8O4S — CID 174423504

IUPACdibenzofuran-2-yl hydrogen sulfite
SMILESO=S(O)Oc1ccc2oc3ccccc3c2c1
InChIInChI=1S/C12H8O4S/c13-17(14)16-8-5-6-12-10(7-8)9-3-1-2-4-11(9)15-12/h1-7H,(H,13,14)
InChIKeyCDGUFFSKOFNQLM-UHFFFAOYSA-N
MW248.26 g/mol
LogP3.10
Rot. Bonds2

About dibenzofuran-2-yl hydrogen sulfite

dibenzofuran-2-yl hydrogen sulfite (PubChem CID 174423504) has the molecular formula C12H8O4S and a molecular weight of 248.26 g/mol. Its IUPAC name is dibenzofuran-2-yl hydrogen sulfite.

Molecular Properties

Compound Namedibenzofuran-2-yl hydrogen sulfite
PubChem CID174423504
Molecular FormulaC12H8O4S
Molecular Weight248.26 g/mol
Exact Mass248.01
IUPAC Namedibenzofuran-2-yl hydrogen sulfite
SMILESO=S(O)Oc1ccc2oc3ccccc3c2c1
InChIInChI=1S/C12H8O4S/c13-17(14)16-8-5-6-12-10(7-8)9-3-1-2-4-11(9)15-12/h1-7H,(H,13,14)
InChIKeyCDGUFFSKOFNQLM-UHFFFAOYSA-N
XLogP3.10
TPSA59.67 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds2
Heavy Atoms17
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500248.26
LogP ≤ 53.10
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'sulfinic_acid', 'substructure': 'N/A'}

Analyze dibenzofuran-2-yl hydrogen sulfite with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of dibenzofuran-2-yl hydrogen sulfite?
The IUPAC name of dibenzofuran-2-yl hydrogen sulfite (CID 174423504) is dibenzofuran-2-yl hydrogen sulfite.
What is the SMILES notation for dibenzofuran-2-yl hydrogen sulfite?
The canonical SMILES for dibenzofuran-2-yl hydrogen sulfite is O=S(O)Oc1ccc2oc3ccccc3c2c1.
What is the InChIKey of dibenzofuran-2-yl hydrogen sulfite?
The InChIKey is CDGUFFSKOFNQLM-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H8O4S/c13-17(14)16-8-5-6-12-10(7-8)9-3-1-2-4-11(9)15-12/h1-7H,(H,13,14).
What are the key properties of dibenzofuran-2-yl hydrogen sulfite?
dibenzofuran-2-yl hydrogen sulfite has a molecular weight of 248.26 g/mol, XLogP of 3.10, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for dibenzofuran-2-yl hydrogen sulfite is sourced from PubChem (CID 174423504), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).