C18H13NO3S — CID 57088845
2-(N-sulfinoanilino)dibenzofuran (PubChem CID 57088845) has the molecular formula C18H13NO3S and a molecular weight of 323.37 g/mol. Its IUPAC name is 2-(N-sulfinoanilino)dibenzofuran.
| Compound Name | 2-(N-sulfinoanilino)dibenzofuran |
|---|---|
| PubChem CID | 57088845 |
| Molecular Formula | C18H13NO3S |
| Molecular Weight | 323.37 g/mol |
| Exact Mass | 323.06 |
| IUPAC Name | 2-(N-sulfinoanilino)dibenzofuran |
| SMILES | O=S(O)N(c1ccccc1)c1ccc2oc3ccccc3c2c1 |
| InChI | InChI=1S/C18H13NO3S/c20-23(21)19(13-6-2-1-3-7-13)14-10-11-18-16(12-14)15-8-4-5-9-17(15)22-18/h1-12H,(H,20,21) |
| InChIKey | OASZVFOWMCTFMB-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 53.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.37 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|