C34H26NO5S2- — CID 69117137
2-[(2-carboxy-1-tritylsulfanylethyl)-sulfinatoamino]dibenzofuran (PubChem CID 69117137) has the molecular formula C34H26NO5S2- and a molecular weight of 592.72 g/mol. Its IUPAC name is 2-[(2-carboxy-1-tritylsulfanylethyl)-sulfinatoamino]dibenzofuran.
| Compound Name | 2-[(2-carboxy-1-tritylsulfanylethyl)-sulfinatoamino]dibenzofuran |
|---|---|
| PubChem CID | 69117137 |
| Molecular Formula | C34H26NO5S2- |
| Molecular Weight | 592.72 g/mol |
| Exact Mass | 592.13 |
| IUPAC Name | 2-[(2-carboxy-1-tritylsulfanylethyl)-sulfinatoamino]dibenzofuran |
| SMILES | O=C(O)CC(SC(c1ccccc1)(c1ccccc1)c1ccccc1)N(c1ccc2oc3ccccc3c2c1)S(=O)[O-] |
| InChI | InChI=1S/C34H27NO5S2/c36-33(37)23-32(35(42(38)39)27-20-21-31-29(22-27)28-18-10-11-19-30(28)40-31)41-34(24-12-4-1-5-13-24,25-14-6-2-7-15-25)26-16-8-3-9-17-26/h1-22,32H,23H2,(H,36,37)(H,38,39)/p-1 |
| InChIKey | UMVPXHUJIZORDM-UHFFFAOYSA-M |
| XLogP | 7.71 |
| TPSA | 93.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.72 |
| LogP ≤ 5 | 7.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|