C19H19N3O4S — CID 41037019
N'-[2-[[(1S)-1-(1-benzofuran-2-yl)ethyl]amino]-2-oxoethyl]-N-(thiophen-2-ylmethyl)oxamide (PubChem CID 41037019) has the molecular formula C19H19N3O4S and a molecular weight of 385.45 g/mol. Its IUPAC name is N'-[2-[[(1S)-1-(1-benzofuran-2-yl)ethyl]amino]-2-oxoethyl]-N-(thiophen-2-ylmethyl)oxamide.
| Compound Name | N'-[2-[[(1S)-1-(1-benzofuran-2-yl)ethyl]amino]-2-oxoethyl]-N-(thiophen-2-ylmethyl)oxamide |
|---|---|
| PubChem CID | 41037019 |
| Molecular Formula | C19H19N3O4S |
| Molecular Weight | 385.45 g/mol |
| Exact Mass | 385.11 |
| IUPAC Name | N'-[2-[[(1S)-1-(1-benzofuran-2-yl)ethyl]amino]-2-oxoethyl]-N-(thiophen-2-ylmethyl)oxamide |
| SMILES | C[C@H](NC(=O)CNC(=O)C(=O)NCc1cccs1)c1cc2ccccc2o1 |
| InChI | InChI=1S/C19H19N3O4S/c1-12(16-9-13-5-2-3-7-15(13)26-16)22-17(23)11-21-19(25)18(24)20-10-14-6-4-8-27-14/h2-9,12H,10-11H2,1H3,(H,20,24)(H,21,25)(H,22,23)/t12-/m0/s1 |
| InChIKey | MLHNLOWEGQKVLK-LBPRGKRZSA-N |
| XLogP | 2.10 |
| TPSA | 100.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.45 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|