C19H19NO4S — CID 9366803
3-(benzenesulfonyl)-N-[(1R)-1-(1-benzofuran-2-yl)ethyl]propanamide (PubChem CID 9366803) has the molecular formula C19H19NO4S and a molecular weight of 357.43 g/mol. Its IUPAC name is 3-(benzenesulfonyl)-N-[(1R)-1-(1-benzofuran-2-yl)ethyl]propanamide.
| Compound Name | 3-(benzenesulfonyl)-N-[(1R)-1-(1-benzofuran-2-yl)ethyl]propanamide |
|---|---|
| PubChem CID | 9366803 |
| Molecular Formula | C19H19NO4S |
| Molecular Weight | 357.43 g/mol |
| Exact Mass | 357.10 |
| IUPAC Name | 3-(benzenesulfonyl)-N-[(1R)-1-(1-benzofuran-2-yl)ethyl]propanamide |
| SMILES | C[C@@H](NC(=O)CCS(=O)(=O)c1ccccc1)c1cc2ccccc2o1 |
| InChI | InChI=1S/C19H19NO4S/c1-14(18-13-15-7-5-6-10-17(15)24-18)20-19(21)11-12-25(22,23)16-8-3-2-4-9-16/h2-10,13-14H,11-12H2,1H3,(H,20,21)/t14-/m1/s1 |
| InChIKey | RLSXSTUYQFFFIK-CQSZACIVSA-N |
| XLogP | 3.47 |
| TPSA | 76.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.43 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |