C19H20N2O4S — CID 9367334
3-(benzenesulfonamido)-N-[(1S)-1-(1-benzofuran-2-yl)ethyl]propanamide (PubChem CID 9367334) has the molecular formula C19H20N2O4S and a molecular weight of 372.45 g/mol. Its IUPAC name is 3-(benzenesulfonamido)-N-[(1S)-1-(1-benzofuran-2-yl)ethyl]propanamide.
| Compound Name | 3-(benzenesulfonamido)-N-[(1S)-1-(1-benzofuran-2-yl)ethyl]propanamide |
|---|---|
| PubChem CID | 9367334 |
| Molecular Formula | C19H20N2O4S |
| Molecular Weight | 372.45 g/mol |
| Exact Mass | 372.11 |
| IUPAC Name | 3-(benzenesulfonamido)-N-[(1S)-1-(1-benzofuran-2-yl)ethyl]propanamide |
| SMILES | C[C@H](NC(=O)CCNS(=O)(=O)c1ccccc1)c1cc2ccccc2o1 |
| InChI | InChI=1S/C19H20N2O4S/c1-14(18-13-15-7-5-6-10-17(15)25-18)21-19(22)11-12-20-26(23,24)16-8-3-2-4-9-16/h2-10,13-14,20H,11-12H2,1H3,(H,21,22)/t14-/m0/s1 |
| InChIKey | ZHXHKVIWQSHILT-AWEZNQCLSA-N |
| XLogP | 2.98 |
| TPSA | 88.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.45 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |