C17H18Cl2N2O3S — CID 43006985
3-(benzenesulfonamido)-N-[1-(3,4-dichlorophenyl)ethyl]propanamide (PubChem CID 43006985) has the molecular formula C17H18Cl2N2O3S and a molecular weight of 401.32 g/mol. Its IUPAC name is 3-(benzenesulfonamido)-N-[1-(3,4-dichlorophenyl)ethyl]propanamide.
| Compound Name | 3-(benzenesulfonamido)-N-[1-(3,4-dichlorophenyl)ethyl]propanamide |
|---|---|
| PubChem CID | 43006985 |
| Molecular Formula | C17H18Cl2N2O3S |
| Molecular Weight | 401.32 g/mol |
| Exact Mass | 400.04 |
| IUPAC Name | 3-(benzenesulfonamido)-N-[1-(3,4-dichlorophenyl)ethyl]propanamide |
| SMILES | CC(NC(=O)CCNS(=O)(=O)c1ccccc1)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C17H18Cl2N2O3S/c1-12(13-7-8-15(18)16(19)11-13)21-17(22)9-10-20-25(23,24)14-5-3-2-4-6-14/h2-8,11-12,20H,9-10H2,1H3,(H,21,22) |
| InChIKey | XCIDLLNDXQWEDU-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.32 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |