C19H24ClN3O5S2 — CID 55948237
3-[(2-chlorophenyl)sulfonylamino]-N-[1-[4-(dimethylsulfamoyl)phenyl]ethyl]propanamide (PubChem CID 55948237) has the molecular formula C19H24ClN3O5S2 and a molecular weight of 474.00 g/mol. Its IUPAC name is 3-[(2-chlorophenyl)sulfonylamino]-N-[1-[4-(dimethylsulfamoyl)phenyl]ethyl]propanamide.
| Compound Name | 3-[(2-chlorophenyl)sulfonylamino]-N-[1-[4-(dimethylsulfamoyl)phenyl]ethyl]propanamide |
|---|---|
| PubChem CID | 55948237 |
| Molecular Formula | C19H24ClN3O5S2 |
| Molecular Weight | 474.00 g/mol |
| Exact Mass | 473.08 |
| IUPAC Name | 3-[(2-chlorophenyl)sulfonylamino]-N-[1-[4-(dimethylsulfamoyl)phenyl]ethyl]propanamide |
| SMILES | CC(NC(=O)CCNS(=O)(=O)c1ccccc1Cl)c1ccc(S(=O)(=O)N(C)C)cc1 |
| InChI | InChI=1S/C19H24ClN3O5S2/c1-14(15-8-10-16(11-9-15)30(27,28)23(2)3)22-19(24)12-13-21-29(25,26)18-7-5-4-6-17(18)20/h4-11,14,21H,12-13H2,1-3H3,(H,22,24) |
| InChIKey | BNHBETXKNRNNGC-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 112.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.00 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |