C18H22ClN3O5S2 — CID 55933849
3-[(2-chlorophenyl)sulfonylamino]-N-[1-[2-(methanesulfonamido)phenyl]ethyl]propanamide (PubChem CID 55933849) has the molecular formula C18H22ClN3O5S2 and a molecular weight of 459.98 g/mol. Its IUPAC name is 3-[(2-chlorophenyl)sulfonylamino]-N-[1-[2-(methanesulfonamido)phenyl]ethyl]propanamide.
| Compound Name | 3-[(2-chlorophenyl)sulfonylamino]-N-[1-[2-(methanesulfonamido)phenyl]ethyl]propanamide |
|---|---|
| PubChem CID | 55933849 |
| Molecular Formula | C18H22ClN3O5S2 |
| Molecular Weight | 459.98 g/mol |
| Exact Mass | 459.07 |
| IUPAC Name | 3-[(2-chlorophenyl)sulfonylamino]-N-[1-[2-(methanesulfonamido)phenyl]ethyl]propanamide |
| SMILES | CC(NC(=O)CCNS(=O)(=O)c1ccccc1Cl)c1ccccc1NS(C)(=O)=O |
| InChI | InChI=1S/C18H22ClN3O5S2/c1-13(14-7-3-5-9-16(14)22-28(2,24)25)21-18(23)11-12-20-29(26,27)17-10-6-4-8-15(17)19/h3-10,13,20,22H,11-12H2,1-2H3,(H,21,23) |
| InChIKey | CIWWDKXCYIKMAR-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 121.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.98 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |