C15H24N2O3S — CID 94062624
N-[(1S)-1-[2-(methanesulfonamido)phenyl]ethyl]-3,3-dimethylbutanamide (PubChem CID 94062624) has the molecular formula C15H24N2O3S and a molecular weight of 312.44 g/mol. Its IUPAC name is N-[(1S)-1-[2-(methanesulfonamido)phenyl]ethyl]-3,3-dimethylbutanamide.
| Compound Name | N-[(1S)-1-[2-(methanesulfonamido)phenyl]ethyl]-3,3-dimethylbutanamide |
|---|---|
| PubChem CID | 94062624 |
| Molecular Formula | C15H24N2O3S |
| Molecular Weight | 312.44 g/mol |
| Exact Mass | 312.15 |
| IUPAC Name | N-[(1S)-1-[2-(methanesulfonamido)phenyl]ethyl]-3,3-dimethylbutanamide |
| SMILES | C[C@H](NC(=O)CC(C)(C)C)c1ccccc1NS(C)(=O)=O |
| InChI | InChI=1S/C15H24N2O3S/c1-11(16-14(18)10-15(2,3)4)12-8-6-7-9-13(12)17-21(5,19)20/h6-9,11,17H,10H2,1-5H3,(H,16,18)/t11-/m0/s1 |
| InChIKey | UUFQUOLFNNCYAI-NSHDSACASA-N |
| XLogP | 2.67 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.44 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |