C12H15F3N2O3S2 — CID 55934103
N-[1-[2-(methanesulfonamido)phenyl]ethyl]-2-(trifluoromethylsulfanyl)acetamide (PubChem CID 55934103) has the molecular formula C12H15F3N2O3S2 and a molecular weight of 356.39 g/mol. Its IUPAC name is N-[1-[2-(methanesulfonamido)phenyl]ethyl]-2-(trifluoromethylsulfanyl)acetamide.
| Compound Name | N-[1-[2-(methanesulfonamido)phenyl]ethyl]-2-(trifluoromethylsulfanyl)acetamide |
|---|---|
| PubChem CID | 55934103 |
| Molecular Formula | C12H15F3N2O3S2 |
| Molecular Weight | 356.39 g/mol |
| Exact Mass | 356.05 |
| IUPAC Name | N-[1-[2-(methanesulfonamido)phenyl]ethyl]-2-(trifluoromethylsulfanyl)acetamide |
| SMILES | CC(NC(=O)CSC(F)(F)F)c1ccccc1NS(C)(=O)=O |
| InChI | InChI=1S/C12H15F3N2O3S2/c1-8(16-11(18)7-21-12(13,14)15)9-5-3-4-6-10(9)17-22(2,19)20/h3-6,8,17H,7H2,1-2H3,(H,16,18) |
| InChIKey | DKGIWPFJUPSWQS-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.39 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |