C17H17FN4O3S — CID 78896037
1-(2-cyano-4-fluorophenyl)-3-[1-[2-(methanesulfonamido)phenyl]ethyl]urea (PubChem CID 78896037) has the molecular formula C17H17FN4O3S and a molecular weight of 376.41 g/mol. Its IUPAC name is 1-(2-cyano-4-fluorophenyl)-3-[1-[2-(methanesulfonamido)phenyl]ethyl]urea.
| Compound Name | 1-(2-cyano-4-fluorophenyl)-3-[1-[2-(methanesulfonamido)phenyl]ethyl]urea |
|---|---|
| PubChem CID | 78896037 |
| Molecular Formula | C17H17FN4O3S |
| Molecular Weight | 376.41 g/mol |
| Exact Mass | 376.10 |
| IUPAC Name | 1-(2-cyano-4-fluorophenyl)-3-[1-[2-(methanesulfonamido)phenyl]ethyl]urea |
| SMILES | CC(NC(=O)Nc1ccc(F)cc1C#N)c1ccccc1NS(C)(=O)=O |
| InChI | InChI=1S/C17H17FN4O3S/c1-11(14-5-3-4-6-16(14)22-26(2,24)25)20-17(23)21-15-8-7-13(18)9-12(15)10-19/h3-9,11,22H,1-2H3,(H2,20,21,23) |
| InChIKey | IZNFOVJKZSGIAZ-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 111.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.41 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |