C16H17F2N3O3S — CID 47050813
1-(2,4-difluorophenyl)-3-[1-[3-(methanesulfonamido)phenyl]ethyl]urea (PubChem CID 47050813) has the molecular formula C16H17F2N3O3S and a molecular weight of 369.39 g/mol. Its IUPAC name is 1-(2,4-difluorophenyl)-3-[1-[3-(methanesulfonamido)phenyl]ethyl]urea.
| Compound Name | 1-(2,4-difluorophenyl)-3-[1-[3-(methanesulfonamido)phenyl]ethyl]urea |
|---|---|
| PubChem CID | 47050813 |
| Molecular Formula | C16H17F2N3O3S |
| Molecular Weight | 369.39 g/mol |
| Exact Mass | 369.10 |
| IUPAC Name | 1-(2,4-difluorophenyl)-3-[1-[3-(methanesulfonamido)phenyl]ethyl]urea |
| SMILES | CC(NC(=O)Nc1ccc(F)cc1F)c1cccc(NS(C)(=O)=O)c1 |
| InChI | InChI=1S/C16H17F2N3O3S/c1-10(11-4-3-5-13(8-11)21-25(2,23)24)19-16(22)20-15-7-6-12(17)9-14(15)18/h3-10,21H,1-2H3,(H2,19,20,22) |
| InChIKey | RVBLCAQVRITVCS-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.39 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |