C16H15F3N2O — CID 146780735
1-(2,4-difluorophenyl)-3-(2-fluoro-4-propan-2-ylphenyl)urea (PubChem CID 146780735) has the molecular formula C16H15F3N2O and a molecular weight of 308.30 g/mol. Its IUPAC name is 1-(2,4-difluorophenyl)-3-(2-fluoro-4-propan-2-ylphenyl)urea.
| Compound Name | 1-(2,4-difluorophenyl)-3-(2-fluoro-4-propan-2-ylphenyl)urea |
|---|---|
| PubChem CID | 146780735 |
| Molecular Formula | C16H15F3N2O |
| Molecular Weight | 308.30 g/mol |
| Exact Mass | 308.11 |
| IUPAC Name | 1-(2,4-difluorophenyl)-3-(2-fluoro-4-propan-2-ylphenyl)urea |
| SMILES | CC(C)c1ccc(NC(=O)Nc2ccc(F)cc2F)c(F)c1 |
| InChI | InChI=1S/C16H15F3N2O/c1-9(2)10-3-5-14(12(18)7-10)20-16(22)21-15-6-4-11(17)8-13(15)19/h3-9H,1-2H3,(H2,20,21,22) |
| InChIKey | RTPSHSKKYKZABX-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.30 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |