C12H15F2NO — CID 2904798
N-(2,4-difluorophenyl)-2-methylpentanamide (PubChem CID 2904798) has the molecular formula C12H15F2NO and a molecular weight of 227.25 g/mol. Its IUPAC name is N-(2,4-difluorophenyl)-2-methylpentanamide.
| Compound Name | N-(2,4-difluorophenyl)-2-methylpentanamide |
|---|---|
| PubChem CID | 2904798 |
| Molecular Formula | C12H15F2NO |
| Molecular Weight | 227.25 g/mol |
| Exact Mass | 227.11 |
| IUPAC Name | N-(2,4-difluorophenyl)-2-methylpentanamide |
| SMILES | CCCC(C)C(=O)Nc1ccc(F)cc1F |
| InChI | InChI=1S/C12H15F2NO/c1-3-4-8(2)12(16)15-11-6-5-9(13)7-10(11)14/h5-8H,3-4H2,1-2H3,(H,15,16) |
| InChIKey | GGUFCVBFBJLYBN-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.25 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |