C12H16F2N2O — CID 6469007
1-(2,4-difluorophenyl)-3-pentan-3-ylurea (PubChem CID 6469007) has the molecular formula C12H16F2N2O and a molecular weight of 242.27 g/mol. Its IUPAC name is 1-(2,4-difluorophenyl)-3-pentan-3-ylurea.
| Compound Name | 1-(2,4-difluorophenyl)-3-pentan-3-ylurea |
|---|---|
| PubChem CID | 6469007 |
| Molecular Formula | C12H16F2N2O |
| Molecular Weight | 242.27 g/mol |
| Exact Mass | 242.12 |
| IUPAC Name | 1-(2,4-difluorophenyl)-3-pentan-3-ylurea |
| SMILES | CCC(CC)NC(=O)Nc1ccc(F)cc1F |
| InChI | InChI=1S/C12H16F2N2O/c1-3-9(4-2)15-12(17)16-11-6-5-8(13)7-10(11)14/h5-7,9H,3-4H2,1-2H3,(H2,15,16,17) |
| InChIKey | FTBBEXLITBIFIG-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.27 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |