C12H17F2N3O — CID 113376862
1-(4-aminopentan-2-yl)-3-(2,4-difluorophenyl)urea (PubChem CID 113376862) has the molecular formula C12H17F2N3O and a molecular weight of 257.28 g/mol. Its IUPAC name is 1-(4-aminopentan-2-yl)-3-(2,4-difluorophenyl)urea.
| Compound Name | 1-(4-aminopentan-2-yl)-3-(2,4-difluorophenyl)urea |
|---|---|
| PubChem CID | 113376862 |
| Molecular Formula | C12H17F2N3O |
| Molecular Weight | 257.28 g/mol |
| Exact Mass | 257.13 |
| IUPAC Name | 1-(4-aminopentan-2-yl)-3-(2,4-difluorophenyl)urea |
| SMILES | CC(N)CC(C)NC(=O)Nc1ccc(F)cc1F |
| InChI | InChI=1S/C12H17F2N3O/c1-7(15)5-8(2)16-12(18)17-11-4-3-9(13)6-10(11)14/h3-4,6-8H,5,15H2,1-2H3,(H2,16,17,18) |
| InChIKey | RENRXGVLGBZEKQ-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.28 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |