C14H21F2N3O — CID 106357317
1-(1-amino-4,4-dimethylpentan-3-yl)-3-(2,4-difluorophenyl)urea (PubChem CID 106357317) has the molecular formula C14H21F2N3O and a molecular weight of 285.34 g/mol. Its IUPAC name is 1-(1-amino-4,4-dimethylpentan-3-yl)-3-(2,4-difluorophenyl)urea.
| Compound Name | 1-(1-amino-4,4-dimethylpentan-3-yl)-3-(2,4-difluorophenyl)urea |
|---|---|
| PubChem CID | 106357317 |
| Molecular Formula | C14H21F2N3O |
| Molecular Weight | 285.34 g/mol |
| Exact Mass | 285.17 |
| IUPAC Name | 1-(1-amino-4,4-dimethylpentan-3-yl)-3-(2,4-difluorophenyl)urea |
| SMILES | CC(C)(C)C(CCN)NC(=O)Nc1ccc(F)cc1F |
| InChI | InChI=1S/C14H21F2N3O/c1-14(2,3)12(6-7-17)19-13(20)18-11-5-4-9(15)8-10(11)16/h4-5,8,12H,6-7,17H2,1-3H3,(H2,18,19,20) |
| InChIKey | VCTWBTWVNLMRPF-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.34 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |