C11H14BrFN2O2 — CID 75379402
1-(2-bromo-5-fluorophenyl)-3-(1-hydroxybutan-2-yl)urea (PubChem CID 75379402) has the molecular formula C11H14BrFN2O2 and a molecular weight of 305.15 g/mol. Its IUPAC name is 1-(2-bromo-5-fluorophenyl)-3-(1-hydroxybutan-2-yl)urea.
| Compound Name | 1-(2-bromo-5-fluorophenyl)-3-(1-hydroxybutan-2-yl)urea |
|---|---|
| PubChem CID | 75379402 |
| Molecular Formula | C11H14BrFN2O2 |
| Molecular Weight | 305.15 g/mol |
| Exact Mass | 304.02 |
| IUPAC Name | 1-(2-bromo-5-fluorophenyl)-3-(1-hydroxybutan-2-yl)urea |
| SMILES | CCC(CO)NC(=O)Nc1cc(F)ccc1Br |
| InChI | InChI=1S/C11H14BrFN2O2/c1-2-8(6-16)14-11(17)15-10-5-7(13)3-4-9(10)12/h3-5,8,16H,2,6H2,1H3,(H2,14,15,17) |
| InChIKey | ZEDBWFXOYFRJLD-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.15 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |