C12H14BrFN2O3 — CID 47224762
N-(2-bromo-4-fluorophenyl)-N'-(1-hydroxybutan-2-yl)oxamide (PubChem CID 47224762) has the molecular formula C12H14BrFN2O3 and a molecular weight of 333.16 g/mol. Its IUPAC name is N-(2-bromo-4-fluorophenyl)-N'-(1-hydroxybutan-2-yl)oxamide.
| Compound Name | N-(2-bromo-4-fluorophenyl)-N'-(1-hydroxybutan-2-yl)oxamide |
|---|---|
| PubChem CID | 47224762 |
| Molecular Formula | C12H14BrFN2O3 |
| Molecular Weight | 333.16 g/mol |
| Exact Mass | 332.02 |
| IUPAC Name | N-(2-bromo-4-fluorophenyl)-N'-(1-hydroxybutan-2-yl)oxamide |
| SMILES | CCC(CO)NC(=O)C(=O)Nc1ccc(F)cc1Br |
| InChI | InChI=1S/C12H14BrFN2O3/c1-2-8(6-17)15-11(18)12(19)16-10-4-3-7(14)5-9(10)13/h3-5,8,17H,2,6H2,1H3,(H,15,18)(H,16,19) |
| InChIKey | DTKXJBZZPQTFNW-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.16 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|