C14H17F3N2O3 — CID 111566618
N'-(1-hydroxybutan-2-yl)-N-[2-methyl-5-(trifluoromethyl)phenyl]oxamide (PubChem CID 111566618) has the molecular formula C14H17F3N2O3 and a molecular weight of 318.30 g/mol. Its IUPAC name is N'-(1-hydroxybutan-2-yl)-N-[2-methyl-5-(trifluoromethyl)phenyl]oxamide.
| Compound Name | N'-(1-hydroxybutan-2-yl)-N-[2-methyl-5-(trifluoromethyl)phenyl]oxamide |
|---|---|
| PubChem CID | 111566618 |
| Molecular Formula | C14H17F3N2O3 |
| Molecular Weight | 318.30 g/mol |
| Exact Mass | 318.12 |
| IUPAC Name | N'-(1-hydroxybutan-2-yl)-N-[2-methyl-5-(trifluoromethyl)phenyl]oxamide |
| SMILES | CCC(CO)NC(=O)C(=O)Nc1cc(C(F)(F)F)ccc1C |
| InChI | InChI=1S/C14H17F3N2O3/c1-3-10(7-20)18-12(21)13(22)19-11-6-9(14(15,16)17)5-4-8(11)2/h4-6,10,20H,3,7H2,1-2H3,(H,18,21)(H,19,22) |
| InChIKey | DRAHVBVEPLOQQT-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.30 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|