C16H21F3N2O3 — CID 111566922
N-(2-ethyl-2-hydroxybutyl)-N'-[2-methyl-5-(trifluoromethyl)phenyl]oxamide (PubChem CID 111566922) has the molecular formula C16H21F3N2O3 and a molecular weight of 346.35 g/mol. Its IUPAC name is N-(2-ethyl-2-hydroxybutyl)-N'-[2-methyl-5-(trifluoromethyl)phenyl]oxamide.
| Compound Name | N-(2-ethyl-2-hydroxybutyl)-N'-[2-methyl-5-(trifluoromethyl)phenyl]oxamide |
|---|---|
| PubChem CID | 111566922 |
| Molecular Formula | C16H21F3N2O3 |
| Molecular Weight | 346.35 g/mol |
| Exact Mass | 346.15 |
| IUPAC Name | N-(2-ethyl-2-hydroxybutyl)-N'-[2-methyl-5-(trifluoromethyl)phenyl]oxamide |
| SMILES | CCC(O)(CC)CNC(=O)C(=O)Nc1cc(C(F)(F)F)ccc1C |
| InChI | InChI=1S/C16H21F3N2O3/c1-4-15(24,5-2)9-20-13(22)14(23)21-12-8-11(16(17,18)19)7-6-10(12)3/h6-8,24H,4-5,9H2,1-3H3,(H,20,22)(H,21,23) |
| InChIKey | JSCUMHPKQIKUOG-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.35 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|