C14H15F3N2O — CID 114291644
2-cyano-2-methyl-N-[2-methyl-5-(trifluoromethyl)phenyl]butanamide (PubChem CID 114291644) has the molecular formula C14H15F3N2O and a molecular weight of 284.28 g/mol. Its IUPAC name is 2-cyano-2-methyl-N-[2-methyl-5-(trifluoromethyl)phenyl]butanamide.
| Compound Name | 2-cyano-2-methyl-N-[2-methyl-5-(trifluoromethyl)phenyl]butanamide |
|---|---|
| PubChem CID | 114291644 |
| Molecular Formula | C14H15F3N2O |
| Molecular Weight | 284.28 g/mol |
| Exact Mass | 284.11 |
| IUPAC Name | 2-cyano-2-methyl-N-[2-methyl-5-(trifluoromethyl)phenyl]butanamide |
| SMILES | CCC(C)(C#N)C(=O)Nc1cc(C(F)(F)F)ccc1C |
| InChI | InChI=1S/C14H15F3N2O/c1-4-13(3,8-18)12(20)19-11-7-10(14(15,16)17)6-5-9(11)2/h5-7H,4H2,1-3H3,(H,19,20) |
| InChIKey | UTSKDLQZFSRAAH-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 52.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.28 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |