C12H12Br2N2O — CID 114291248
2-cyano-N-(2,5-dibromophenyl)-2-methylbutanamide (PubChem CID 114291248) has the molecular formula C12H12Br2N2O and a molecular weight of 360.05 g/mol. Its IUPAC name is 2-cyano-N-(2,5-dibromophenyl)-2-methylbutanamide.
| Compound Name | 2-cyano-N-(2,5-dibromophenyl)-2-methylbutanamide |
|---|---|
| PubChem CID | 114291248 |
| Molecular Formula | C12H12Br2N2O |
| Molecular Weight | 360.05 g/mol |
| Exact Mass | 357.93 |
| IUPAC Name | 2-cyano-N-(2,5-dibromophenyl)-2-methylbutanamide |
| SMILES | CCC(C)(C#N)C(=O)Nc1cc(Br)ccc1Br |
| InChI | InChI=1S/C12H12Br2N2O/c1-3-12(2,7-15)11(17)16-10-6-8(13)4-5-9(10)14/h4-6H,3H2,1-2H3,(H,16,17) |
| InChIKey | LTTPYIOHJSMKLR-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 52.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.05 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |