C13H12Br2N2 — CID 138636157
2-[1-(2,5-dibromoanilino)ethenyl]-3-methylbut-2-enenitrile (PubChem CID 138636157) has the molecular formula C13H12Br2N2 and a molecular weight of 356.06 g/mol. Its IUPAC name is 2-[1-(2,5-dibromoanilino)ethenyl]-3-methylbut-2-enenitrile.
| Compound Name | 2-[1-(2,5-dibromoanilino)ethenyl]-3-methylbut-2-enenitrile |
|---|---|
| PubChem CID | 138636157 |
| Molecular Formula | C13H12Br2N2 |
| Molecular Weight | 356.06 g/mol |
| Exact Mass | 353.94 |
| IUPAC Name | 2-[1-(2,5-dibromoanilino)ethenyl]-3-methylbut-2-enenitrile |
| SMILES | C=C(Nc1cc(Br)ccc1Br)C(C#N)=C(C)C |
| InChI | InChI=1S/C13H12Br2N2/c1-8(2)11(7-16)9(3)17-13-6-10(14)4-5-12(13)15/h4-6,17H,3H2,1-2H3 |
| InChIKey | PJRBKNVYRWWECC-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 35.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.06 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|