C10H7Br2Cl2NO — CID 78860380
2,2-dichloro-N-(2,5-dibromophenyl)cyclopropane-1-carboxamide (PubChem CID 78860380) has the molecular formula C10H7Br2Cl2NO and a molecular weight of 387.89 g/mol. Its IUPAC name is 2,2-dichloro-N-(2,5-dibromophenyl)cyclopropane-1-carboxamide.
| Compound Name | 2,2-dichloro-N-(2,5-dibromophenyl)cyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 78860380 |
| Molecular Formula | C10H7Br2Cl2NO |
| Molecular Weight | 387.89 g/mol |
| Exact Mass | 384.83 |
| IUPAC Name | 2,2-dichloro-N-(2,5-dibromophenyl)cyclopropane-1-carboxamide |
| SMILES | O=C(Nc1cc(Br)ccc1Br)C1CC1(Cl)Cl |
| InChI | InChI=1S/C10H7Br2Cl2NO/c11-5-1-2-7(12)8(3-5)15-9(16)6-4-10(6,13)14/h1-3,6H,4H2,(H,15,16) |
| InChIKey | WMKQSCBOCRZOFI-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.89 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|