C10H10Br2ClNO — CID 63307782
4-chloro-N-(2,5-dibromophenyl)butanamide (PubChem CID 63307782) has the molecular formula C10H10Br2ClNO and a molecular weight of 355.46 g/mol. Its IUPAC name is 4-chloro-N-(2,5-dibromophenyl)butanamide.
| Compound Name | 4-chloro-N-(2,5-dibromophenyl)butanamide |
|---|---|
| PubChem CID | 63307782 |
| Molecular Formula | C10H10Br2ClNO |
| Molecular Weight | 355.46 g/mol |
| Exact Mass | 352.88 |
| IUPAC Name | 4-chloro-N-(2,5-dibromophenyl)butanamide |
| SMILES | O=C(CCCCl)Nc1cc(Br)ccc1Br |
| InChI | InChI=1S/C10H10Br2ClNO/c11-7-3-4-8(12)9(6-7)14-10(15)2-1-5-13/h3-4,6H,1-2,5H2,(H,14,15) |
| InChIKey | MIMGNHJDGHXSOK-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.46 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|