C18H18Br2N2O3 — CID 55874161
benzyl N-[4-(2,5-dibromoanilino)-4-oxobutyl]carbamate (PubChem CID 55874161) has the molecular formula C18H18Br2N2O3 and a molecular weight of 470.16 g/mol. Its IUPAC name is benzyl N-[4-(2,5-dibromoanilino)-4-oxobutyl]carbamate.
| Compound Name | benzyl N-[4-(2,5-dibromoanilino)-4-oxobutyl]carbamate |
|---|---|
| PubChem CID | 55874161 |
| Molecular Formula | C18H18Br2N2O3 |
| Molecular Weight | 470.16 g/mol |
| Exact Mass | 467.97 |
| IUPAC Name | benzyl N-[4-(2,5-dibromoanilino)-4-oxobutyl]carbamate |
| SMILES | O=C(CCCNC(=O)OCc1ccccc1)Nc1cc(Br)ccc1Br |
| InChI | InChI=1S/C18H18Br2N2O3/c19-14-8-9-15(20)16(11-14)22-17(23)7-4-10-21-18(24)25-12-13-5-2-1-3-6-13/h1-3,5-6,8-9,11H,4,7,10,12H2,(H,21,24)(H,22,23) |
| InChIKey | IIEJEMFSKTWTQV-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.16 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|