C26H28N2O3 — CID 56522555
benzyl N-[4-(1,1-diphenylethylamino)-4-oxobutyl]carbamate (PubChem CID 56522555) has the molecular formula C26H28N2O3 and a molecular weight of 416.52 g/mol. Its IUPAC name is benzyl N-[4-(1,1-diphenylethylamino)-4-oxobutyl]carbamate.
| Compound Name | benzyl N-[4-(1,1-diphenylethylamino)-4-oxobutyl]carbamate |
|---|---|
| PubChem CID | 56522555 |
| Molecular Formula | C26H28N2O3 |
| Molecular Weight | 416.52 g/mol |
| Exact Mass | 416.21 |
| IUPAC Name | benzyl N-[4-(1,1-diphenylethylamino)-4-oxobutyl]carbamate |
| SMILES | CC(NC(=O)CCCNC(=O)OCc1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C26H28N2O3/c1-26(22-14-7-3-8-15-22,23-16-9-4-10-17-23)28-24(29)18-11-19-27-25(30)31-20-21-12-5-2-6-13-21/h2-10,12-17H,11,18-20H2,1H3,(H,27,30)(H,28,29) |
| InChIKey | NLBJGKITKFQSOE-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.52 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|