C22H27ClN2O3 — CID 55904718
benzyl N-[4-[[2-(4-chlorophenyl)-2-methylpropyl]amino]-4-oxobutyl]carbamate (PubChem CID 55904718) has the molecular formula C22H27ClN2O3 and a molecular weight of 402.92 g/mol. Its IUPAC name is benzyl N-[4-[[2-(4-chlorophenyl)-2-methylpropyl]amino]-4-oxobutyl]carbamate.
| Compound Name | benzyl N-[4-[[2-(4-chlorophenyl)-2-methylpropyl]amino]-4-oxobutyl]carbamate |
|---|---|
| PubChem CID | 55904718 |
| Molecular Formula | C22H27ClN2O3 |
| Molecular Weight | 402.92 g/mol |
| Exact Mass | 402.17 |
| IUPAC Name | benzyl N-[4-[[2-(4-chlorophenyl)-2-methylpropyl]amino]-4-oxobutyl]carbamate |
| SMILES | CC(C)(CNC(=O)CCCNC(=O)OCc1ccccc1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C22H27ClN2O3/c1-22(2,18-10-12-19(23)13-11-18)16-25-20(26)9-6-14-24-21(27)28-15-17-7-4-3-5-8-17/h3-5,7-8,10-13H,6,9,14-16H2,1-2H3,(H,24,27)(H,25,26) |
| InChIKey | HSZMOQNUBGLQSP-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.92 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|