C21H25N3O4 — CID 55872499
benzyl N-[4-[2-(dimethylcarbamoyl)anilino]-4-oxobutyl]carbamate (PubChem CID 55872499) has the molecular formula C21H25N3O4 and a molecular weight of 383.45 g/mol. Its IUPAC name is benzyl N-[4-[2-(dimethylcarbamoyl)anilino]-4-oxobutyl]carbamate.
| Compound Name | benzyl N-[4-[2-(dimethylcarbamoyl)anilino]-4-oxobutyl]carbamate |
|---|---|
| PubChem CID | 55872499 |
| Molecular Formula | C21H25N3O4 |
| Molecular Weight | 383.45 g/mol |
| Exact Mass | 383.18 |
| IUPAC Name | benzyl N-[4-[2-(dimethylcarbamoyl)anilino]-4-oxobutyl]carbamate |
| SMILES | CN(C)C(=O)c1ccccc1NC(=O)CCCNC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C21H25N3O4/c1-24(2)20(26)17-11-6-7-12-18(17)23-19(25)13-8-14-22-21(27)28-15-16-9-4-3-5-10-16/h3-7,9-12H,8,13-15H2,1-2H3,(H,22,27)(H,23,25) |
| InChIKey | PLMDDIVSQRDEFQ-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.45 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|