C23H29N3O4 — CID 55822545
benzyl N-[4-[[2-(2,6-dimethylanilino)-2-oxoethyl]-methylamino]-4-oxobutyl]carbamate (PubChem CID 55822545) has the molecular formula C23H29N3O4 and a molecular weight of 411.50 g/mol. Its IUPAC name is benzyl N-[4-[[2-(2,6-dimethylanilino)-2-oxoethyl]-methylamino]-4-oxobutyl]carbamate.
| Compound Name | benzyl N-[4-[[2-(2,6-dimethylanilino)-2-oxoethyl]-methylamino]-4-oxobutyl]carbamate |
|---|---|
| PubChem CID | 55822545 |
| Molecular Formula | C23H29N3O4 |
| Molecular Weight | 411.50 g/mol |
| Exact Mass | 411.22 |
| IUPAC Name | benzyl N-[4-[[2-(2,6-dimethylanilino)-2-oxoethyl]-methylamino]-4-oxobutyl]carbamate |
| SMILES | Cc1cccc(C)c1NC(=O)CN(C)C(=O)CCCNC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C23H29N3O4/c1-17-9-7-10-18(2)22(17)25-20(27)15-26(3)21(28)13-8-14-24-23(29)30-16-19-11-5-4-6-12-19/h4-7,9-12H,8,13-16H2,1-3H3,(H,24,29)(H,25,27) |
| InChIKey | NRCHFRDUOIILMZ-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.50 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|