C8H6Br2ClNO — CID 3433301
2-chloro-N-(2,5-dibromophenyl)acetamide (PubChem CID 3433301) has the molecular formula C8H6Br2ClNO and a molecular weight of 327.40 g/mol. Its IUPAC name is 2-chloro-N-(2,5-dibromophenyl)acetamide.
| Compound Name | 2-chloro-N-(2,5-dibromophenyl)acetamide |
|---|---|
| PubChem CID | 3433301 |
| Molecular Formula | C8H6Br2ClNO |
| Molecular Weight | 327.40 g/mol |
| Exact Mass | 324.85 |
| IUPAC Name | 2-chloro-N-(2,5-dibromophenyl)acetamide |
| SMILES | O=C(CCl)Nc1cc(Br)ccc1Br |
| InChI | InChI=1S/C8H6Br2ClNO/c9-5-1-2-6(10)7(3-5)12-8(13)4-11/h1-3H,4H2,(H,12,13) |
| InChIKey | QAJQAXOTHSJAJS-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.40 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|