C17H21Br2N3O2 — CID 55760620
N-(2,5-dibromophenyl)-1-(pyrrolidine-1-carbonyl)piperidine-4-carboxamide (PubChem CID 55760620) has the molecular formula C17H21Br2N3O2 and a molecular weight of 459.18 g/mol. Its IUPAC name is N-(2,5-dibromophenyl)-1-(pyrrolidine-1-carbonyl)piperidine-4-carboxamide.
| Compound Name | N-(2,5-dibromophenyl)-1-(pyrrolidine-1-carbonyl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 55760620 |
| Molecular Formula | C17H21Br2N3O2 |
| Molecular Weight | 459.18 g/mol |
| Exact Mass | 457.00 |
| IUPAC Name | N-(2,5-dibromophenyl)-1-(pyrrolidine-1-carbonyl)piperidine-4-carboxamide |
| SMILES | O=C(Nc1cc(Br)ccc1Br)C1CCN(C(=O)N2CCCC2)CC1 |
| InChI | InChI=1S/C17H21Br2N3O2/c18-13-3-4-14(19)15(11-13)20-16(23)12-5-9-22(10-6-12)17(24)21-7-1-2-8-21/h3-4,11-12H,1-2,5-10H2,(H,20,23) |
| InChIKey | BYAAAOXXSNAYAD-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.18 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |