C17H22BrN3O3 — CID 91651859
N-(4-bromo-3-hydroxyphenyl)-1-(pyrrolidine-1-carbonyl)piperidine-4-carboxamide (PubChem CID 91651859) has the molecular formula C17H22BrN3O3 and a molecular weight of 396.29 g/mol. Its IUPAC name is N-(4-bromo-3-hydroxyphenyl)-1-(pyrrolidine-1-carbonyl)piperidine-4-carboxamide.
| Compound Name | N-(4-bromo-3-hydroxyphenyl)-1-(pyrrolidine-1-carbonyl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 91651859 |
| Molecular Formula | C17H22BrN3O3 |
| Molecular Weight | 396.29 g/mol |
| Exact Mass | 395.08 |
| IUPAC Name | N-(4-bromo-3-hydroxyphenyl)-1-(pyrrolidine-1-carbonyl)piperidine-4-carboxamide |
| SMILES | O=C(Nc1ccc(Br)c(O)c1)C1CCN(C(=O)N2CCCC2)CC1 |
| InChI | InChI=1S/C17H22BrN3O3/c18-14-4-3-13(11-15(14)22)19-16(23)12-5-9-21(10-6-12)17(24)20-7-1-2-8-20/h3-4,11-12,22H,1-2,5-10H2,(H,19,23) |
| InChIKey | JPYXRUVUYDUUDJ-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 72.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.29 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |