C12H8Br2N2O4 — CID 54728569
(Z)-4-cyano-5-(2,5-dibromoanilino)-3-hydroxy-5-oxopent-3-enoic acid (PubChem CID 54728569) has the molecular formula C12H8Br2N2O4 and a molecular weight of 404.01 g/mol. Its IUPAC name is (Z)-4-cyano-5-(2,5-dibromoanilino)-3-hydroxy-5-oxopent-3-enoic acid.
| Compound Name | (Z)-4-cyano-5-(2,5-dibromoanilino)-3-hydroxy-5-oxopent-3-enoic acid |
|---|---|
| PubChem CID | 54728569 |
| Molecular Formula | C12H8Br2N2O4 |
| Molecular Weight | 404.01 g/mol |
| Exact Mass | 401.89 |
| IUPAC Name | (Z)-4-cyano-5-(2,5-dibromoanilino)-3-hydroxy-5-oxopent-3-enoic acid |
| SMILES | N#C/C(C(=O)Nc1cc(Br)ccc1Br)=C(/O)CC(=O)O |
| InChI | InChI=1S/C12H8Br2N2O4/c13-6-1-2-8(14)9(3-6)16-12(20)7(5-15)10(17)4-11(18)19/h1-3,17H,4H2,(H,16,20)(H,18,19)/b10-7- |
| InChIKey | FIMQCJQBCPEESC-YFHOEESVSA-N |
| XLogP | 2.96 |
| TPSA | 110.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.01 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|