C11H10Br2N2O5 — CID 61468309
2-[2-[(2,5-dibromophenyl)carbamoylamino]-2-oxoethoxy]acetic acid (PubChem CID 61468309) has the molecular formula C11H10Br2N2O5 and a molecular weight of 410.02 g/mol. Its IUPAC name is 2-[2-[(2,5-dibromophenyl)carbamoylamino]-2-oxoethoxy]acetic acid.
| Compound Name | 2-[2-[(2,5-dibromophenyl)carbamoylamino]-2-oxoethoxy]acetic acid |
|---|---|
| PubChem CID | 61468309 |
| Molecular Formula | C11H10Br2N2O5 |
| Molecular Weight | 410.02 g/mol |
| Exact Mass | 407.90 |
| IUPAC Name | 2-[2-[(2,5-dibromophenyl)carbamoylamino]-2-oxoethoxy]acetic acid |
| SMILES | O=C(O)COCC(=O)NC(=O)Nc1cc(Br)ccc1Br |
| InChI | InChI=1S/C11H10Br2N2O5/c12-6-1-2-7(13)8(3-6)14-11(19)15-9(16)4-20-5-10(17)18/h1-3H,4-5H2,(H,17,18)(H2,14,15,16,19) |
| InChIKey | OQVLCIWACVYMSS-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 104.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.02 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |