C13H16N2O6 — CID 61326948
2-[2-[(2-methoxy-5-methylphenyl)carbamoylamino]-2-oxoethoxy]acetic acid (PubChem CID 61326948) has the molecular formula C13H16N2O6 and a molecular weight of 296.28 g/mol. Its IUPAC name is 2-[2-[(2-methoxy-5-methylphenyl)carbamoylamino]-2-oxoethoxy]acetic acid.
| Compound Name | 2-[2-[(2-methoxy-5-methylphenyl)carbamoylamino]-2-oxoethoxy]acetic acid |
|---|---|
| PubChem CID | 61326948 |
| Molecular Formula | C13H16N2O6 |
| Molecular Weight | 296.28 g/mol |
| Exact Mass | 296.10 |
| IUPAC Name | 2-[2-[(2-methoxy-5-methylphenyl)carbamoylamino]-2-oxoethoxy]acetic acid |
| SMILES | COc1ccc(C)cc1NC(=O)NC(=O)COCC(=O)O |
| InChI | InChI=1S/C13H16N2O6/c1-8-3-4-10(20-2)9(5-8)14-13(19)15-11(16)6-21-7-12(17)18/h3-5H,6-7H2,1-2H3,(H,17,18)(H2,14,15,16,19) |
| InChIKey | BUYXXXFKVSTAKW-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 113.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.28 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |