C13H16N2O6 — CID 28746034
4-[(2,5-dimethoxyphenyl)carbamoylamino]-4-oxobutanoic acid (PubChem CID 28746034) has the molecular formula C13H16N2O6 and a molecular weight of 296.28 g/mol. Its IUPAC name is 4-[(2,5-dimethoxyphenyl)carbamoylamino]-4-oxobutanoic acid.
| Compound Name | 4-[(2,5-dimethoxyphenyl)carbamoylamino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 28746034 |
| Molecular Formula | C13H16N2O6 |
| Molecular Weight | 296.28 g/mol |
| Exact Mass | 296.10 |
| IUPAC Name | 4-[(2,5-dimethoxyphenyl)carbamoylamino]-4-oxobutanoic acid |
| SMILES | COc1ccc(OC)c(NC(=O)NC(=O)CCC(=O)O)c1 |
| InChI | InChI=1S/C13H16N2O6/c1-20-8-3-4-10(21-2)9(7-8)14-13(19)15-11(16)5-6-12(17)18/h3-4,7H,5-6H2,1-2H3,(H,17,18)(H2,14,15,16,19) |
| InChIKey | NDSJWEFHIDBTAR-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 113.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.28 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |