C11H12N2O7S — CID 61329440
2-[2-[(2-methoxycarbonylthiophen-3-yl)carbamoylamino]-2-oxoethoxy]acetic acid (PubChem CID 61329440) has the molecular formula C11H12N2O7S and a molecular weight of 316.29 g/mol. Its IUPAC name is 2-[2-[(2-methoxycarbonylthiophen-3-yl)carbamoylamino]-2-oxoethoxy]acetic acid.
| Compound Name | 2-[2-[(2-methoxycarbonylthiophen-3-yl)carbamoylamino]-2-oxoethoxy]acetic acid |
|---|---|
| PubChem CID | 61329440 |
| Molecular Formula | C11H12N2O7S |
| Molecular Weight | 316.29 g/mol |
| Exact Mass | 316.04 |
| IUPAC Name | 2-[2-[(2-methoxycarbonylthiophen-3-yl)carbamoylamino]-2-oxoethoxy]acetic acid |
| SMILES | COC(=O)c1sccc1NC(=O)NC(=O)COCC(=O)O |
| InChI | InChI=1S/C11H12N2O7S/c1-19-10(17)9-6(2-3-21-9)12-11(18)13-7(14)4-20-5-8(15)16/h2-3H,4-5H2,1H3,(H,15,16)(H2,12,13,14,18) |
| InChIKey | QQMLGYPVMUGTQB-UHFFFAOYSA-N |
| XLogP | 0.28 |
| TPSA | 131.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.29 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |