C10H7Br2N3O2 — CID 54955294
N-(cyanomethyl)-N'-(2,5-dibromophenyl)oxamide (PubChem CID 54955294) has the molecular formula C10H7Br2N3O2 and a molecular weight of 360.99 g/mol. Its IUPAC name is N-(cyanomethyl)-N'-(2,5-dibromophenyl)oxamide.
| Compound Name | N-(cyanomethyl)-N'-(2,5-dibromophenyl)oxamide |
|---|---|
| PubChem CID | 54955294 |
| Molecular Formula | C10H7Br2N3O2 |
| Molecular Weight | 360.99 g/mol |
| Exact Mass | 358.89 |
| IUPAC Name | N-(cyanomethyl)-N'-(2,5-dibromophenyl)oxamide |
| SMILES | N#CCNC(=O)C(=O)Nc1cc(Br)ccc1Br |
| InChI | InChI=1S/C10H7Br2N3O2/c11-6-1-2-7(12)8(5-6)15-10(17)9(16)14-4-3-13/h1-2,5H,4H2,(H,14,16)(H,15,17) |
| InChIKey | FGEDFPWBEYSILV-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 81.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.99 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|