C10H10Br2N2O — CID 47033525
1-(2,5-dibromophenyl)-3-prop-2-enylurea (PubChem CID 47033525) has the molecular formula C10H10Br2N2O and a molecular weight of 334.01 g/mol. Its IUPAC name is 1-(2,5-dibromophenyl)-3-prop-2-enylurea.
| Compound Name | 1-(2,5-dibromophenyl)-3-prop-2-enylurea |
|---|---|
| PubChem CID | 47033525 |
| Molecular Formula | C10H10Br2N2O |
| Molecular Weight | 334.01 g/mol |
| Exact Mass | 331.92 |
| IUPAC Name | 1-(2,5-dibromophenyl)-3-prop-2-enylurea |
| SMILES | C=CCNC(=O)Nc1cc(Br)ccc1Br |
| InChI | InChI=1S/C10H10Br2N2O/c1-2-5-13-10(15)14-9-6-7(11)3-4-8(9)12/h2-4,6H,1,5H2,(H2,13,14,15) |
| InChIKey | DDUFUEJKDCPQHI-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.01 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|