C11H11BrN2O2S — CID 91687024
4-bromo-3-(prop-2-enylcarbamothioylamino)benzoic acid (PubChem CID 91687024) has the molecular formula C11H11BrN2O2S and a molecular weight of 315.19 g/mol. Its IUPAC name is 4-bromo-3-(prop-2-enylcarbamothioylamino)benzoic acid.
| Compound Name | 4-bromo-3-(prop-2-enylcarbamothioylamino)benzoic acid |
|---|---|
| PubChem CID | 91687024 |
| Molecular Formula | C11H11BrN2O2S |
| Molecular Weight | 315.19 g/mol |
| Exact Mass | 313.97 |
| IUPAC Name | 4-bromo-3-(prop-2-enylcarbamothioylamino)benzoic acid |
| SMILES | C=CCNC(=S)Nc1cc(C(=O)O)ccc1Br |
| InChI | InChI=1S/C11H11BrN2O2S/c1-2-5-13-11(17)14-9-6-7(10(15)16)3-4-8(9)12/h2-4,6H,1,5H2,(H,15,16)(H2,13,14,17) |
| InChIKey | OWPVDGVZPVYHHF-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.19 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|