C10H10BrNO4S — CID 107812686
4-bromo-3-(prop-2-enylsulfonylamino)benzoic acid (PubChem CID 107812686) has the molecular formula C10H10BrNO4S and a molecular weight of 320.16 g/mol. Its IUPAC name is 4-bromo-3-(prop-2-enylsulfonylamino)benzoic acid.
| Compound Name | 4-bromo-3-(prop-2-enylsulfonylamino)benzoic acid |
|---|---|
| PubChem CID | 107812686 |
| Molecular Formula | C10H10BrNO4S |
| Molecular Weight | 320.16 g/mol |
| Exact Mass | 318.95 |
| IUPAC Name | 4-bromo-3-(prop-2-enylsulfonylamino)benzoic acid |
| SMILES | C=CCS(=O)(=O)Nc1cc(C(=O)O)ccc1Br |
| InChI | InChI=1S/C10H10BrNO4S/c1-2-5-17(15,16)12-9-6-7(10(13)14)3-4-8(9)11/h2-4,6,12H,1,5H2,(H,13,14) |
| InChIKey | BPAKWNHCCWHRHT-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.16 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|