C10H12N2O4S — CID 114324399
2-[(prop-2-enylsulfonylamino)methyl]pyridine-4-carboxylic acid (PubChem CID 114324399) has the molecular formula C10H12N2O4S and a molecular weight of 256.28 g/mol. Its IUPAC name is 2-[(prop-2-enylsulfonylamino)methyl]pyridine-4-carboxylic acid.
| Compound Name | 2-[(prop-2-enylsulfonylamino)methyl]pyridine-4-carboxylic acid |
|---|---|
| PubChem CID | 114324399 |
| Molecular Formula | C10H12N2O4S |
| Molecular Weight | 256.28 g/mol |
| Exact Mass | 256.05 |
| IUPAC Name | 2-[(prop-2-enylsulfonylamino)methyl]pyridine-4-carboxylic acid |
| SMILES | C=CCS(=O)(=O)NCc1cc(C(=O)O)ccn1 |
| InChI | InChI=1S/C10H12N2O4S/c1-2-5-17(15,16)12-7-9-6-8(10(13)14)3-4-11-9/h2-4,6,12H,1,5,7H2,(H,13,14) |
| InChIKey | MTTSPKHYKLGWKJ-UHFFFAOYSA-N |
| XLogP | 0.39 |
| TPSA | 96.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.28 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|