C13H14BrNO5S — CID 43323864
4-bromo-3-[1-oxo-1-(prop-2-enylamino)propan-2-yl]sulfonylbenzoic acid (PubChem CID 43323864) has the molecular formula C13H14BrNO5S and a molecular weight of 376.23 g/mol. Its IUPAC name is 4-bromo-3-[1-oxo-1-(prop-2-enylamino)propan-2-yl]sulfonylbenzoic acid.
| Compound Name | 4-bromo-3-[1-oxo-1-(prop-2-enylamino)propan-2-yl]sulfonylbenzoic acid |
|---|---|
| PubChem CID | 43323864 |
| Molecular Formula | C13H14BrNO5S |
| Molecular Weight | 376.23 g/mol |
| Exact Mass | 374.98 |
| IUPAC Name | 4-bromo-3-[1-oxo-1-(prop-2-enylamino)propan-2-yl]sulfonylbenzoic acid |
| SMILES | C=CCNC(=O)C(C)S(=O)(=O)c1cc(C(=O)O)ccc1Br |
| InChI | InChI=1S/C13H14BrNO5S/c1-3-6-15-12(16)8(2)21(19,20)11-7-9(13(17)18)4-5-10(11)14/h3-5,7-8H,1,6H2,2H3,(H,15,16)(H,17,18) |
| InChIKey | KTDWAXZBXQFFAP-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 100.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.23 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|