C10H9F2NO4S — CID 79672480
2,4-difluoro-5-(prop-2-enylsulfonylamino)benzoic acid (PubChem CID 79672480) has the molecular formula C10H9F2NO4S and a molecular weight of 277.25 g/mol. Its IUPAC name is 2,4-difluoro-5-(prop-2-enylsulfonylamino)benzoic acid.
| Compound Name | 2,4-difluoro-5-(prop-2-enylsulfonylamino)benzoic acid |
|---|---|
| PubChem CID | 79672480 |
| Molecular Formula | C10H9F2NO4S |
| Molecular Weight | 277.25 g/mol |
| Exact Mass | 277.02 |
| IUPAC Name | 2,4-difluoro-5-(prop-2-enylsulfonylamino)benzoic acid |
| SMILES | C=CCS(=O)(=O)Nc1cc(C(=O)O)c(F)cc1F |
| InChI | InChI=1S/C10H9F2NO4S/c1-2-3-18(16,17)13-9-4-6(10(14)15)7(11)5-8(9)12/h2,4-5,13H,1,3H2,(H,14,15) |
| InChIKey | ZDMMSHNRLPGOGQ-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.25 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|