2,4-difluoro-5-(prop-2-enylsulfonylamino)benzoic acid

C10H9F2NO4S — CID 79672480

IUPAC2,4-difluoro-5-(prop-2-enylsulfonylamino)benzoic acid
SMILESC=CCS(=O)(=O)Nc1cc(C(=O)O)c(F)cc1F
InChIInChI=1S/C10H9F2NO4S/c1-2-3-18(16,17)13-9-4-6(10(14)15)7(11)5-8(9)12/h2,4-5,13H,1,3H2,(H,14,15)
InChIKeyZDMMSHNRLPGOGQ-UHFFFAOYSA-N
MW277.25 g/mol
LogP1.59
Rot. Bonds5

About 2,4-difluoro-5-(prop-2-enylsulfonylamino)benzoic acid

2,4-difluoro-5-(prop-2-enylsulfonylamino)benzoic acid (PubChem CID 79672480) has the molecular formula C10H9F2NO4S and a molecular weight of 277.25 g/mol. Its IUPAC name is 2,4-difluoro-5-(prop-2-enylsulfonylamino)benzoic acid.

Molecular Properties

Compound Name2,4-difluoro-5-(prop-2-enylsulfonylamino)benzoic acid
PubChem CID79672480
Molecular FormulaC10H9F2NO4S
Molecular Weight277.25 g/mol
Exact Mass277.02
IUPAC Name2,4-difluoro-5-(prop-2-enylsulfonylamino)benzoic acid
SMILESC=CCS(=O)(=O)Nc1cc(C(=O)O)c(F)cc1F
InChIInChI=1S/C10H9F2NO4S/c1-2-3-18(16,17)13-9-4-6(10(14)15)7(11)5-8(9)12/h2,4-5,13H,1,3H2,(H,14,15)
InChIKeyZDMMSHNRLPGOGQ-UHFFFAOYSA-N
XLogP1.59
TPSA83.47 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds5
Heavy Atoms18
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500277.25
LogP ≤ 51.59
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'isolated_alkene', 'substructure': 'N/A'}

Analyze 2,4-difluoro-5-(prop-2-enylsulfonylamino)benzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2,4-difluoro-5-(prop-2-enylsulfonylamino)benzoic acid?
The IUPAC name of 2,4-difluoro-5-(prop-2-enylsulfonylamino)benzoic acid (CID 79672480) is 2,4-difluoro-5-(prop-2-enylsulfonylamino)benzoic acid.
What is the SMILES notation for 2,4-difluoro-5-(prop-2-enylsulfonylamino)benzoic acid?
The canonical SMILES for 2,4-difluoro-5-(prop-2-enylsulfonylamino)benzoic acid is C=CCS(=O)(=O)Nc1cc(C(=O)O)c(F)cc1F.
What is the InChIKey of 2,4-difluoro-5-(prop-2-enylsulfonylamino)benzoic acid?
The InChIKey is ZDMMSHNRLPGOGQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9F2NO4S/c1-2-3-18(16,17)13-9-4-6(10(14)15)7(11)5-8(9)12/h2,4-5,13H,1,3H2,(H,14,15).
What are the key properties of 2,4-difluoro-5-(prop-2-enylsulfonylamino)benzoic acid?
2,4-difluoro-5-(prop-2-enylsulfonylamino)benzoic acid has a molecular weight of 277.25 g/mol, XLogP of 1.59, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,4-difluoro-5-(prop-2-enylsulfonylamino)benzoic acid is sourced from PubChem (CID 79672480), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).