C15H10Br2N2O3S — CID 91673572
4-bromo-3-[(4-bromobenzoyl)carbamothioylamino]benzoic acid (PubChem CID 91673572) has the molecular formula C15H10Br2N2O3S and a molecular weight of 458.13 g/mol. Its IUPAC name is 4-bromo-3-[(4-bromobenzoyl)carbamothioylamino]benzoic acid.
| Compound Name | 4-bromo-3-[(4-bromobenzoyl)carbamothioylamino]benzoic acid |
|---|---|
| PubChem CID | 91673572 |
| Molecular Formula | C15H10Br2N2O3S |
| Molecular Weight | 458.13 g/mol |
| Exact Mass | 455.88 |
| IUPAC Name | 4-bromo-3-[(4-bromobenzoyl)carbamothioylamino]benzoic acid |
| SMILES | O=C(O)c1ccc(Br)c(NC(=S)NC(=O)c2ccc(Br)cc2)c1 |
| InChI | InChI=1S/C15H10Br2N2O3S/c16-10-4-1-8(2-5-10)13(20)19-15(23)18-12-7-9(14(21)22)3-6-11(12)17/h1-7H,(H,21,22)(H2,18,19,20,23) |
| InChIKey | RWTSPMZXSHFKQQ-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.13 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|