C20H15BrN2O4S — CID 91673634
4-bromo-3-[(3-methoxynaphthalene-2-carbonyl)carbamothioylamino]benzoic acid (PubChem CID 91673634) has the molecular formula C20H15BrN2O4S and a molecular weight of 459.32 g/mol. Its IUPAC name is 4-bromo-3-[(3-methoxynaphthalene-2-carbonyl)carbamothioylamino]benzoic acid.
| Compound Name | 4-bromo-3-[(3-methoxynaphthalene-2-carbonyl)carbamothioylamino]benzoic acid |
|---|---|
| PubChem CID | 91673634 |
| Molecular Formula | C20H15BrN2O4S |
| Molecular Weight | 459.32 g/mol |
| Exact Mass | 457.99 |
| IUPAC Name | 4-bromo-3-[(3-methoxynaphthalene-2-carbonyl)carbamothioylamino]benzoic acid |
| SMILES | COc1cc2ccccc2cc1C(=O)NC(=S)Nc1cc(C(=O)O)ccc1Br |
| InChI | InChI=1S/C20H15BrN2O4S/c1-27-17-10-12-5-3-2-4-11(12)8-14(17)18(24)23-20(28)22-16-9-13(19(25)26)6-7-15(16)21/h2-10H,1H3,(H,25,26)(H2,22,23,24,28) |
| InChIKey | QKARTVGJKNXAKH-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.32 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|